C18H30N2O4S — CID 155501296
2,2,3,3-tetramethyl-N-[[(1S,5S,6R,7R)-3-methylsulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 155501296) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[[(1S,5S,6R,7R)-3-methylsulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2,3,3-tetramethyl-N-[[(1S,5S,6R,7R)-3-methylsulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 155501296 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[[(1S,5S,6R,7R)-3-methylsulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C(=O)NC[C@H]2[C@H]3CN(S(C)(=O)=O)C[C@]34CC[C@H]2O4)C1(C)C |
| InChI | InChI=1S/C18H30N2O4S/c1-16(2)14(17(16,3)4)15(21)19-8-11-12-9-20(25(5,22)23)10-18(12)7-6-13(11)24-18/h11-14H,6-10H2,1-5H3,(H,19,21)/t11-,12+,13+,18+/m0/s1 |
| InChIKey | XWXBQMOAZRKRTH-NVAPZFDKSA-N |
| XLogP | 1.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |