C22H24ClN3O3 — CID 155501859
N-(2-chloro-6-methylphenyl)-3-[(4-cyano-2-methoxyphenoxy)methyl]piperidine-1-carboxamide (PubChem CID 155501859) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-3-[(4-cyano-2-methoxyphenoxy)methyl]piperidine-1-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-3-[(4-cyano-2-methoxyphenoxy)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 155501859 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-3-[(4-cyano-2-methoxyphenoxy)methyl]piperidine-1-carboxamide |
| SMILES | COc1cc(C#N)ccc1OCC1CCCN(C(=O)Nc2c(C)cccc2Cl)C1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-15-5-3-7-18(23)21(15)25-22(27)26-10-4-6-17(13-26)14-29-19-9-8-16(12-24)11-20(19)28-2/h3,5,7-9,11,17H,4,6,10,13-14H2,1-2H3,(H,25,27) |
| InChIKey | UKUNAXRMPAUULX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |