C18H20N4O3 — CID 155918127
3-methoxy-4-[[1-(1H-pyrazole-4-carbonyl)piperidin-3-yl]methoxy]benzonitrile (PubChem CID 155918127) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-methoxy-4-[[1-(1H-pyrazole-4-carbonyl)piperidin-3-yl]methoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[[1-(1H-pyrazole-4-carbonyl)piperidin-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 155918127 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-methoxy-4-[[1-(1H-pyrazole-4-carbonyl)piperidin-3-yl]methoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC1CCCN(C(=O)c2cn[nH]c2)C1 |
| InChI | InChI=1S/C18H20N4O3/c1-24-17-7-13(8-19)4-5-16(17)25-12-14-3-2-6-22(11-14)18(23)15-9-20-21-10-15/h4-5,7,9-10,14H,2-3,6,11-12H2,1H3,(H,20,21) |
| InChIKey | DAAFALWSXRNVIC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |