C13H23N3O3S — CID 155504004
(3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-ol (PubChem CID 155504004) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-ol.
| Compound Name | (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 155504004 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-ol |
| SMILES | COCCC[C@@]1(CO)CN(c2nnc(C)s2)CC[C@H]1O |
| InChI | InChI=1S/C13H23N3O3S/c1-10-14-15-12(20-10)16-6-4-11(18)13(8-16,9-17)5-3-7-19-2/h11,17-18H,3-9H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | BJLFRODSKWIDCK-YPMHNXCESA-N |
| XLogP | 0.82 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|