C19H27N5O3 — CID 155504096
4-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]benzamide (PubChem CID 155504096) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 155504096 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]benzamide |
| SMILES | CCOCCn1nc(-c2ccc(C(N)=O)cc2)nc1[C@H]1CC[C@@H](O)[C@H](N)C1 |
| InChI | InChI=1S/C19H27N5O3/c1-2-27-10-9-24-19(14-7-8-16(25)15(20)11-14)22-18(23-24)13-5-3-12(4-6-13)17(21)26/h3-6,14-16,25H,2,7-11,20H2,1H3,(H2,21,26)/t14-,15+,16+/m0/s1 |
| InChIKey | LHHNFCYUPIQVGZ-ARFHVFGLSA-N |
| XLogP | 1.04 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|