C24H36N2O5S — CID 15550619
tert-butyl 4-methyl-4-[4-(4-methylsulfonylbenzoyl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 15550619) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-[4-(4-methylsulfonylbenzoyl)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-4-[4-(4-methylsulfonylbenzoyl)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15550619 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | tert-butyl 4-methyl-4-[4-(4-methylsulfonylbenzoyl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(N2CCC(C(=O)c3ccc(S(C)(=O)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H36N2O5S/c1-23(2,3)31-22(28)25-16-12-24(4,13-17-25)26-14-10-19(11-15-26)21(27)18-6-8-20(9-7-18)32(5,29)30/h6-9,19H,10-17H2,1-5H3 |
| InChIKey | VNUQGGUTSGRCOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |