C19H18FN3O — CID 155506342
(3S,4R)-1-(3-fluoro-4-pyridinyl)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol (PubChem CID 155506342) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is (3S,4R)-1-(3-fluoro-4-pyridinyl)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-(3-fluoro-4-pyridinyl)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155506342 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3S,4R)-1-(3-fluoro-4-pyridinyl)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(c2ccncc2F)C[C@H]1Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H18FN3O/c20-16-10-21-8-7-18(16)23-11-14(19(24)12-23)9-15-6-5-13-3-1-2-4-17(13)22-15/h1-8,10,14,19,24H,9,11-12H2/t14-,19-/m1/s1 |
| InChIKey | SNMZRVGLNPYVOU-AUUYWEPGSA-N |
| XLogP | 2.81 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |