C21H31F2N3O — CID 155507201
(3R,7S,8aS)-N-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155507201) has the molecular formula C21H31F2N3O and a molecular weight of 379.50 g/mol. Its IUPAC name is (3R,7S,8aS)-N-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3R,7S,8aS)-N-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155507201 |
| Molecular Formula | C21H31F2N3O |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (3R,7S,8aS)-N-[1-(3,4-difluorophenyl)piperidin-4-yl]-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NC3CCN(c4ccc(F)c(F)c4)CC3)C[C@H]2CO1 |
| InChI | InChI=1S/C21H31F2N3O/c1-14(2)21-12-26-11-16(9-18(26)13-27-21)24-15-5-7-25(8-6-15)17-3-4-19(22)20(23)10-17/h3-4,10,14-16,18,21,24H,5-9,11-13H2,1-2H3/t16-,18-,21-/m0/s1 |
| InChIKey | QKNLTDOXHFCKCX-MDKPJZGXSA-N |
| XLogP | 3.02 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |