C22H31N3O5 — CID 155507784
(6R,7S,8aS)-6-(4-methoxyphenyl)-2-(3-methoxypropanoyl)-4-oxo-N-propyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 155507784) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is (6R,7S,8aS)-6-(4-methoxyphenyl)-2-(3-methoxypropanoyl)-4-oxo-N-propyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6R,7S,8aS)-6-(4-methoxyphenyl)-2-(3-methoxypropanoyl)-4-oxo-N-propyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155507784 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (6R,7S,8aS)-6-(4-methoxyphenyl)-2-(3-methoxypropanoyl)-4-oxo-N-propyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CCCNC(=O)[C@H]1C[C@H]2CN(C(=O)CCOC)CC(=O)N2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H31N3O5/c1-4-10-23-22(28)18-12-16-13-24(19(26)9-11-29-2)14-20(27)25(16)21(18)15-5-7-17(30-3)8-6-15/h5-8,16,18,21H,4,9-14H2,1-3H3,(H,23,28)/t16-,18-,21-/m0/s1 |
| InChIKey | LSGZQYLQHVABLI-MDKPJZGXSA-N |
| XLogP | 1.36 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |