C23H26N4O4 — CID 154818539
(6R,7S,8aS)-2-acetyl-6-(4-methoxyphenyl)-4-oxo-N-(pyridin-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 154818539) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is (6R,7S,8aS)-2-acetyl-6-(4-methoxyphenyl)-4-oxo-N-(pyridin-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6R,7S,8aS)-2-acetyl-6-(4-methoxyphenyl)-4-oxo-N-(pyridin-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154818539 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (6R,7S,8aS)-2-acetyl-6-(4-methoxyphenyl)-4-oxo-N-(pyridin-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | COc1ccc([C@H]2[C@@H](C(=O)NCc3cccnc3)C[C@H]3CN(C(C)=O)CC(=O)N32)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-15(28)26-13-18-10-20(23(30)25-12-16-4-3-9-24-11-16)22(27(18)21(29)14-26)17-5-7-19(31-2)8-6-17/h3-9,11,18,20,22H,10,12-14H2,1-2H3,(H,25,30)/t18-,20-,22-/m0/s1 |
| InChIKey | FXVNUVFPZJMVMG-VCOUNFBDSA-N |
| XLogP | 1.53 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |