C19H22N4O2 — CID 166294994
(1R,4R)-5-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 166294994) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (1R,4R)-5-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,4R)-5-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 166294994 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (1R,4R)-5-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | COc1ccc(N2C[C@H]3C[C@@H]2CN3C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-25-18-6-4-15(5-7-18)22-12-17-9-16(22)13-23(17)19(24)21-11-14-3-2-8-20-10-14/h2-8,10,16-17H,9,11-13H2,1H3,(H,21,24)/t16-,17-/m1/s1 |
| InChIKey | AKHMBDGQIOGZMI-IAGOWNOFSA-N |
| XLogP | 2.26 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|