C17H26N2O2 — CID 155508835
[(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]-pyridin-4-ylmethanone (PubChem CID 155508835) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]-pyridin-4-ylmethanone.
| Compound Name | [(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 155508835 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]-pyridin-4-ylmethanone |
| SMILES | CCCC[C@@H]1CN(C(=O)c2ccncc2)C[C@H](C(C)C)O1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-5-6-15-11-19(12-16(21-15)13(2)3)17(20)14-7-9-18-10-8-14/h7-10,13,15-16H,4-6,11-12H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | KRLOPPGTMFXHLB-HZPDHXFCSA-N |
| XLogP | 3.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |