C24H38N2O4 — CID 155971738
[4-[(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]piperidin-1-yl]-phenylmethanone;formic acid (PubChem CID 155971738) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is [4-[(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]piperidin-1-yl]-phenylmethanone;formic acid.
| Compound Name | [4-[(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]piperidin-1-yl]-phenylmethanone;formic acid |
|---|---|
| PubChem CID | 155971738 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | [4-[(2R,6S)-2-butyl-6-propan-2-ylmorpholin-4-yl]piperidin-1-yl]-phenylmethanone;formic acid |
| SMILES | CCCC[C@@H]1CN(C2CCN(C(=O)c3ccccc3)CC2)C[C@H](C(C)C)O1.O=CO |
| InChI | InChI=1S/C23H36N2O2.CH2O2/c1-4-5-11-21-16-25(17-22(27-21)18(2)3)20-12-14-24(15-13-20)23(26)19-9-7-6-8-10-19;2-1-3/h6-10,18,20-22H,4-5,11-17H2,1-3H3;1H,(H,2,3)/t21-,22-;/m1./s1 |
| InChIKey | BQRVCIMFNDNNGQ-HLUKFBSCSA-N |
| XLogP | 3.91 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|