C20H27N3O3 — CID 154819980
(5aS,8aS)-7-(1-benzoylpiperidin-4-yl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one (PubChem CID 154819980) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (5aS,8aS)-7-(1-benzoylpiperidin-4-yl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one.
| Compound Name | (5aS,8aS)-7-(1-benzoylpiperidin-4-yl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 154819980 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (5aS,8aS)-7-(1-benzoylpiperidin-4-yl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
| SMILES | CN1C(=O)CCO[C@H]2CN(C3CCN(C(=O)c4ccccc4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C20H27N3O3/c1-21-17-13-23(14-18(17)26-12-9-19(21)24)16-7-10-22(11-8-16)20(25)15-5-3-2-4-6-15/h2-6,16-18H,7-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | IDKPBBHIRJLLGK-ROUUACIJSA-N |
| XLogP | 1.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |