About 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one
4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one (PubChem CID 15550915) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one |
| PubChem CID | 15550915 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)C(C)(C)C2C2=CCCCC2)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-19(2)17(15-7-5-4-6-8-15)20(18(19)21)13-14-9-11-16(22-3)12-10-14/h7,9-12,17H,4-6,8,13H2,1-3H3 |
| InChIKey | HIFAPCIJSDLWIF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one?
The IUPAC name of 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one (CID 15550915) is 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one?
The canonical SMILES for 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one is COc1ccc(CN2C(=O)C(C)(C)C2C2=CCCCC2)cc1.
What is the InChIKey of 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one?
The InChIKey is HIFAPCIJSDLWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2/c1-19(2)17(15-7-5-4-6-8-15)20(18(19)21)13-14-9-11-16(22-3)12-10-14/h7,9-12,17H,4-6,8,13H2,1-3H3.
What are the key properties of 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one?
4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one has a molecular weight of 299.41 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexen-1-yl)-1-[(4-methoxyphenyl)methyl]-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 15550915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).