C14H19FN2O3 — CID 155509778
(1S,3S,4S)-3-amino-N-[2-(2-fluorophenoxy)ethyl]-4-hydroxycyclopentane-1-carboxamide (PubChem CID 155509778) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is (1S,3S,4S)-3-amino-N-[2-(2-fluorophenoxy)ethyl]-4-hydroxycyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-3-amino-N-[2-(2-fluorophenoxy)ethyl]-4-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155509778 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (1S,3S,4S)-3-amino-N-[2-(2-fluorophenoxy)ethyl]-4-hydroxycyclopentane-1-carboxamide |
| SMILES | N[C@H]1C[C@H](C(=O)NCCOc2ccccc2F)C[C@@H]1O |
| InChI | InChI=1S/C14H19FN2O3/c15-10-3-1-2-4-13(10)20-6-5-17-14(19)9-7-11(16)12(18)8-9/h1-4,9,11-12,18H,5-8,16H2,(H,17,19)/t9-,11-,12-/m0/s1 |
| InChIKey | BLCCJGLBTFPBSD-DLOVCJGASA-N |
| XLogP | 0.42 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|