C22H23NO3S2 — CID 155510289
2-methyl-N,2-bis(4-methylphenyl)-3-thiophen-2-ylsulfonylpropanamide (PubChem CID 155510289) has the molecular formula C22H23NO3S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-methyl-N,2-bis(4-methylphenyl)-3-thiophen-2-ylsulfonylpropanamide.
| Compound Name | 2-methyl-N,2-bis(4-methylphenyl)-3-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 155510289 |
| Molecular Formula | C22H23NO3S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-methyl-N,2-bis(4-methylphenyl)-3-thiophen-2-ylsulfonylpropanamide |
| SMILES | Cc1ccc(NC(=O)C(C)(CS(=O)(=O)c2cccs2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H23NO3S2/c1-16-6-10-18(11-7-16)22(3,15-28(25,26)20-5-4-14-27-20)21(24)23-19-12-8-17(2)9-13-19/h4-14H,15H2,1-3H3,(H,23,24) |
| InChIKey | PMKMYUNDPLKRIO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |