C13H10BrF2N3O2 — CID 155511256
1-[5-bromo-4-(2,6-difluorophenoxy)-2-pyridinyl]-3-methylurea (PubChem CID 155511256) has the molecular formula C13H10BrF2N3O2 and a molecular weight of 358.14 g/mol. Its IUPAC name is 1-[5-bromo-4-(2,6-difluorophenoxy)-2-pyridinyl]-3-methylurea.
| Compound Name | 1-[5-bromo-4-(2,6-difluorophenoxy)-2-pyridinyl]-3-methylurea |
|---|---|
| PubChem CID | 155511256 |
| Molecular Formula | C13H10BrF2N3O2 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 1-[5-bromo-4-(2,6-difluorophenoxy)-2-pyridinyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(Oc2c(F)cccc2F)c(Br)cn1 |
| InChI | InChI=1S/C13H10BrF2N3O2/c1-17-13(20)19-11-5-10(7(14)6-18-11)21-12-8(15)3-2-4-9(12)16/h2-6H,1H3,(H2,17,18,19,20) |
| InChIKey | ZYQONBSSQQQJCH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |