C9H13N3O — CID 177139787
1-(4,5-dimethyl-2-pyridinyl)-3-methylurea (PubChem CID 177139787) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-pyridinyl)-3-methylurea.
| Compound Name | 1-(4,5-dimethyl-2-pyridinyl)-3-methylurea |
|---|---|
| PubChem CID | 177139787 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-(4,5-dimethyl-2-pyridinyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(C)c(C)cn1 |
| InChI | InChI=1S/C9H13N3O/c1-6-4-8(11-5-7(6)2)12-9(13)10-3/h4-5H,1-3H3,(H2,10,11,12,13) |
| InChIKey | CENIIARLTUMLBB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |