C7H10N4O — CID 70667568
1-methyl-3-(5-methylpyrimidin-2-yl)urea (PubChem CID 70667568) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-methyl-3-(5-methylpyrimidin-2-yl)urea.
| Compound Name | 1-methyl-3-(5-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 70667568 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-methyl-3-(5-methylpyrimidin-2-yl)urea |
| SMILES | CNC(=O)Nc1ncc(C)cn1 |
| InChI | InChI=1S/C7H10N4O/c1-5-3-9-6(10-4-5)11-7(12)8-2/h3-4H,1-2H3,(H2,8,9,10,11,12) |
| InChIKey | ZKZKGTMLSMZXLM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |