C8H10ClN3O — CID 20827630
1-(3-chloro-5-methyl-2-pyridinyl)-3-methylurea (PubChem CID 20827630) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 1-(3-chloro-5-methyl-2-pyridinyl)-3-methylurea.
| Compound Name | 1-(3-chloro-5-methyl-2-pyridinyl)-3-methylurea |
|---|---|
| PubChem CID | 20827630 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 1-(3-chloro-5-methyl-2-pyridinyl)-3-methylurea |
| SMILES | CNC(=O)Nc1ncc(C)cc1Cl |
| InChI | InChI=1S/C8H10ClN3O/c1-5-3-6(9)7(11-4-5)12-8(13)10-2/h3-4H,1-2H3,(H2,10,11,12,13) |
| InChIKey | BVSZNGOJBKGZPP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |