C10H12ClN3O4 — CID 139292576
ethyl N-[[3-chloro-5-(hydroxymethyl)-2-pyridinyl]carbamoyl]carbamate (PubChem CID 139292576) has the molecular formula C10H12ClN3O4 and a molecular weight of 273.68 g/mol. Its IUPAC name is ethyl N-[[3-chloro-5-(hydroxymethyl)-2-pyridinyl]carbamoyl]carbamate.
| Compound Name | ethyl N-[[3-chloro-5-(hydroxymethyl)-2-pyridinyl]carbamoyl]carbamate |
|---|---|
| PubChem CID | 139292576 |
| Molecular Formula | C10H12ClN3O4 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | ethyl N-[[3-chloro-5-(hydroxymethyl)-2-pyridinyl]carbamoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)Nc1ncc(CO)cc1Cl |
| InChI | InChI=1S/C10H12ClN3O4/c1-2-18-10(17)14-9(16)13-8-7(11)3-6(5-15)4-12-8/h3-4,15H,2,5H2,1H3,(H2,12,13,14,16,17) |
| InChIKey | OXVJGGNYUUVXEK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |