C32H30ClN5O4 — CID 155512698
N-(1-benzylpiperidin-4-yl)-7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-2-oxochromene-3-carboxamide (PubChem CID 155512698) has the molecular formula C32H30ClN5O4 and a molecular weight of 584.08 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-2-oxochromene-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 155512698 |
| Molecular Formula | C32H30ClN5O4 |
| Molecular Weight | 584.08 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cc2ccc(OCc3cn(Cc4ccccc4Cl)nn3)cc2oc1=O |
| InChI | InChI=1S/C32H30ClN5O4/c33-29-9-5-4-8-24(29)19-38-20-26(35-36-38)21-41-27-11-10-23-16-28(32(40)42-30(23)17-27)31(39)34-25-12-14-37(15-13-25)18-22-6-2-1-3-7-22/h1-11,16-17,20,25H,12-15,18-19,21H2,(H,34,39) |
| InChIKey | BMAFZEZVHNPNJX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.08 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|