C24H27N3O4 — CID 171911394
2-oxo-7-propan-2-yloxy-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]chromene-3-carboxamide (PubChem CID 171911394) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-oxo-7-propan-2-yloxy-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]chromene-3-carboxamide.
| Compound Name | 2-oxo-7-propan-2-yloxy-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 171911394 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-oxo-7-propan-2-yloxy-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]chromene-3-carboxamide |
| SMILES | CC(C)Oc1ccc2cc(C(=O)NC3CCN(Cc4cccnc4)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H27N3O4/c1-16(2)30-20-6-5-18-12-21(24(29)31-22(18)13-20)23(28)26-19-7-10-27(11-8-19)15-17-4-3-9-25-14-17/h3-6,9,12-14,16,19H,7-8,10-11,15H2,1-2H3,(H,26,28) |
| InChIKey | MFWWMDYXIFVQTB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|