C24H16ClNO2 — CID 155513146
2-(3-chlorophenyl)-4-(2-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol (PubChem CID 155513146) has the molecular formula C24H16ClNO2 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-(2-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol.
| Compound Name | 2-(3-chlorophenyl)-4-(2-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol |
|---|---|
| PubChem CID | 155513146 |
| Molecular Formula | C24H16ClNO2 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(3-chlorophenyl)-4-(2-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol |
| SMILES | Oc1ccccc1-c1cc(-c2cccc(Cl)c2)nc2c1Cc1cccc(O)c1-2 |
| InChI | InChI=1S/C24H16ClNO2/c25-16-7-3-5-14(11-16)20-13-18(17-8-1-2-9-21(17)27)19-12-15-6-4-10-22(28)23(15)24(19)26-20/h1-11,13,27-28H,12H2 |
| InChIKey | NOQSISHJQXKBAA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |