C33H31Cl2N5O8 — CID 155514892
(4S)-5-anilino-4-[[(2S)-3-carboxy-2-[[(2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoyl]amino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 155514892) has the molecular formula C33H31Cl2N5O8 and a molecular weight of 696.54 g/mol. Its IUPAC name is (4S)-5-anilino-4-[[(2S)-3-carboxy-2-[[(2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoyl]amino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-anilino-4-[[(2S)-3-carboxy-2-[[(2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 155514892 |
| Molecular Formula | C33H31Cl2N5O8 |
| Molecular Weight | 696.54 g/mol |
| Exact Mass | 695.15 |
| IUPAC Name | (4S)-5-anilino-4-[[(2S)-3-carboxy-2-[[(2S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1Cl)NC(=O)c1cc2cc(Cl)ccc2[nH]1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H31Cl2N5O8/c34-20-10-11-23-19(14-20)16-25(37-23)31(46)39-26(15-18-6-4-5-9-22(18)35)32(47)40-27(17-29(43)44)33(48)38-24(12-13-28(41)42)30(45)36-21-7-2-1-3-8-21/h1-11,14,16,24,26-27,37H,12-13,15,17H2,(H,36,45)(H,38,48)(H,39,46)(H,40,47)(H,41,42)(H,43,44)/t24-,26-,27-/m0/s1 |
| InChIKey | ZEBLUANOECYZRT-URORMMCBSA-N |
| XLogP | 3.76 |
| TPSA | 206.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |