C23H25FN6O4 — CID 155515016
2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzoic acid (PubChem CID 155515016) has the molecular formula C23H25FN6O4 and a molecular weight of 468.49 g/mol. Its IUPAC name is 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzoic acid.
| Compound Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 155515016 |
| Molecular Formula | C23H25FN6O4 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzoic acid |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1cccc(F)c1C(=O)O)c(=O)n2C |
| InChI | InChI=1S/C23H25FN6O4/c1-3-4-11-29-18-19(26-22(29)28-10-6-8-15(25)13-28)27(2)23(34)30(20(18)31)12-14-7-5-9-16(24)17(14)21(32)33/h5,7,9,15H,6,8,10-13,25H2,1-2H3,(H,32,33)/t15-/m1/s1 |
| InChIKey | NGLLZVXEXYETPR-OAHLLOKOSA-N |
| XLogP | 0.73 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|