C25H29ClN6O4 — CID 155533304
ethyl 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate (PubChem CID 155533304) has the molecular formula C25H29ClN6O4 and a molecular weight of 513.00 g/mol. Its IUPAC name is ethyl 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate.
| Compound Name | ethyl 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate |
|---|---|
| PubChem CID | 155533304 |
| Molecular Formula | C25H29ClN6O4 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | ethyl 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1ccc(Cl)cc1C(=O)OCC)c(=O)n2C |
| InChI | InChI=1S/C25H29ClN6O4/c1-4-6-12-31-20-21(28-24(31)30-11-7-8-18(27)15-30)29(3)25(35)32(22(20)33)14-16-9-10-17(26)13-19(16)23(34)36-5-2/h9-10,13,18H,5,7-8,11-12,14-15,27H2,1-3H3/t18-/m1/s1 |
| InChIKey | VCHMPLFDXLHUOD-GOSISDBHSA-N |
| XLogP | 1.73 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|