C21H18N6O3 — CID 155515119
3-[(4-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide (PubChem CID 155515119) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide.
| Compound Name | 3-[(4-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 155515119 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-[(4-methoxyphenyl)diazenyl]-N-(3-methoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)benzamide |
| SMILES | COc1ccc(/N=N/c2cccc(C(=O)Nc3cnc4[nH]nc(OC)c4c3)c2)cc1 |
| InChI | InChI=1S/C21H18N6O3/c1-29-17-8-6-14(7-9-17)24-25-15-5-3-4-13(10-15)20(28)23-16-11-18-19(22-12-16)26-27-21(18)30-2/h3-12H,1-2H3,(H,23,28)(H,22,26,27)/b25-24+ |
| InChIKey | ITCOZRYRTPXZEE-OCOZRVBESA-N |
| XLogP | 4.64 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|