C23H26N4O3 — CID 155516099
1-[1-[3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]-7-propoxyindolizin-3-yl]ethanone (PubChem CID 155516099) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[1-[3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]-7-propoxyindolizin-3-yl]ethanone.
| Compound Name | 1-[1-[3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]-7-propoxyindolizin-3-yl]ethanone |
|---|---|
| PubChem CID | 155516099 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[1-[3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]-7-propoxyindolizin-3-yl]ethanone |
| SMILES | CCCOc1ccn2c(C(C)=O)cc(-c3nc4ccccn4c3NCCOC)c2c1 |
| InChI | InChI=1S/C23H26N4O3/c1-4-12-30-17-8-11-26-19(16(2)28)15-18(20(26)14-17)22-23(24-9-13-29-3)27-10-6-5-7-21(27)25-22/h5-8,10-11,14-15,24H,4,9,12-13H2,1-3H3 |
| InChIKey | BFPHHEAZFVQIKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|