C20H19NO4S — CID 155517141
(1R)-N-hydroxy-2-[4-(2-phenylethynyl)phenyl]sulfonylcyclopentane-1-carboxamide (PubChem CID 155517141) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is (1R)-N-hydroxy-2-[4-(2-phenylethynyl)phenyl]sulfonylcyclopentane-1-carboxamide.
| Compound Name | (1R)-N-hydroxy-2-[4-(2-phenylethynyl)phenyl]sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155517141 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (1R)-N-hydroxy-2-[4-(2-phenylethynyl)phenyl]sulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1CCCC1S(=O)(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO4S/c22-20(21-23)18-7-4-8-19(18)26(24,25)17-13-11-16(12-14-17)10-9-15-5-2-1-3-6-15/h1-3,5-6,11-14,18-19,23H,4,7-8H2,(H,21,22)/t18-,19?/m0/s1 |
| InChIKey | GDIVQVJILGFMET-OYKVQYDMSA-N |
| XLogP | 2.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|