C18H19FN2O4S — CID 57162835
1-amino-3-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxycyclopentane-1-carboxamide (PubChem CID 57162835) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-amino-3-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxycyclopentane-1-carboxamide.
| Compound Name | 1-amino-3-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 57162835 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-amino-3-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxycyclopentane-1-carboxamide |
| SMILES | NC1(C(=O)NO)CCC(S(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C18H19FN2O4S/c19-14-5-1-12(2-6-14)13-3-7-15(8-4-13)26(24,25)16-9-10-18(20,11-16)17(22)21-23/h1-8,16,23H,9-11,20H2,(H,21,22) |
| InChIKey | RJKHCHVQCFLRRM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|