C25H31N3O6S — CID 155517718
tert-butyl 3-oxo-4-[2-(2,4,6-trimethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate (PubChem CID 155517718) has the molecular formula C25H31N3O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is tert-butyl 3-oxo-4-[2-(2,4,6-trimethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate.
| Compound Name | tert-butyl 3-oxo-4-[2-(2,4,6-trimethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
|---|---|
| PubChem CID | 155517718 |
| Molecular Formula | C25H31N3O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | tert-butyl 3-oxo-4-[2-(2,4,6-trimethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
| SMILES | COc1cc(OC)c(CCn2cnc3sc4c(c3c2=O)CCN(C(=O)OC(C)(C)C)C4)c(OC)c1 |
| InChI | InChI=1S/C25H31N3O6S/c1-25(2,3)34-24(30)27-9-8-17-20(13-27)35-22-21(17)23(29)28(14-26-22)10-7-16-18(32-5)11-15(31-4)12-19(16)33-6/h11-12,14H,7-10,13H2,1-6H3 |
| InChIKey | TUEMRGHWMNOCPV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |