C32H29N3O3S — CID 42795639
11-(2,2-diphenylacetyl)-4-[2-(2-methoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 42795639) has the molecular formula C32H29N3O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is 11-(2,2-diphenylacetyl)-4-[2-(2-methoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-(2,2-diphenylacetyl)-4-[2-(2-methoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 42795639 |
| Molecular Formula | C32H29N3O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 11-(2,2-diphenylacetyl)-4-[2-(2-methoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COc1ccccc1CCn1cnc2sc3c(c2c1=O)CCN(C(=O)C(c1ccccc1)c1ccccc1)C3 |
| InChI | InChI=1S/C32H29N3O3S/c1-38-26-15-9-8-10-22(26)16-18-35-21-33-30-29(32(35)37)25-17-19-34(20-27(25)39-30)31(36)28(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-15,21,28H,16-20H2,1H3 |
| InChIKey | XBXLDGQTKBJTIV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |