C23H28N4O4S2 — CID 155543528
4-[2-(2-methoxyphenyl)ethyl]-11-piperidin-1-ylsulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 155543528) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)ethyl]-11-piperidin-1-ylsulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[2-(2-methoxyphenyl)ethyl]-11-piperidin-1-ylsulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 155543528 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)ethyl]-11-piperidin-1-ylsulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COc1ccccc1CCn1cnc2sc3c(c2c1=O)CCN(S(=O)(=O)N1CCCCC1)C3 |
| InChI | InChI=1S/C23H28N4O4S2/c1-31-19-8-4-3-7-17(19)9-13-25-16-24-22-21(23(25)28)18-10-14-27(15-20(18)32-22)33(29,30)26-11-5-2-6-12-26/h3-4,7-8,16H,2,5-6,9-15H2,1H3 |
| InChIKey | KBJFLNHUSYJTSU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |