C20H24N4O4S2 — CID 155524156
4-[2-(2-methoxyphenyl)ethyl]-N,N-dimethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide (PubChem CID 155524156) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)ethyl]-N,N-dimethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide.
| Compound Name | 4-[2-(2-methoxyphenyl)ethyl]-N,N-dimethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide |
|---|---|
| PubChem CID | 155524156 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)ethyl]-N,N-dimethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide |
| SMILES | COc1ccccc1CCn1cnc2sc3c(c2c1=O)CCN(S(=O)(=O)N(C)C)C3 |
| InChI | InChI=1S/C20H24N4O4S2/c1-22(2)30(26,27)24-11-9-15-17(12-24)29-19-18(15)20(25)23(13-21-19)10-8-14-6-4-5-7-16(14)28-3/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | POPFQBKOBJMISL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |