C26H23N3O6 — CID 155517722
4-methyl-7-[[1-[4-(2-oxochromen-7-yl)oxybutyl]triazol-4-yl]methoxy]chromen-2-one (PubChem CID 155517722) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is 4-methyl-7-[[1-[4-(2-oxochromen-7-yl)oxybutyl]triazol-4-yl]methoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[[1-[4-(2-oxochromen-7-yl)oxybutyl]triazol-4-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 155517722 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-methyl-7-[[1-[4-(2-oxochromen-7-yl)oxybutyl]triazol-4-yl]methoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3cn(CCCCOc4ccc5ccc(=O)oc5c4)nn3)ccc12 |
| InChI | InChI=1S/C26H23N3O6/c1-17-12-26(31)35-24-14-21(7-8-22(17)24)33-16-19-15-29(28-27-19)10-2-3-11-32-20-6-4-18-5-9-25(30)34-23(18)13-20/h4-9,12-15H,2-3,10-11,16H2,1H3 |
| InChIKey | CRQJIBCBTZTSOY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|