C18H16N6O — CID 155517964
N-[(E)-benzylideneamino]-2-[5-[(E)-2-phenylethenyl]tetrazol-2-yl]acetamide (PubChem CID 155517964) has the molecular formula C18H16N6O and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[5-[(E)-2-phenylethenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[5-[(E)-2-phenylethenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 155517964 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[5-[(E)-2-phenylethenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(/C=C/c2ccccc2)n1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C18H16N6O/c25-18(21-19-13-16-9-5-2-6-10-16)14-24-22-17(20-23-24)12-11-15-7-3-1-4-8-15/h1-13H,14H2,(H,21,25)/b12-11+,19-13+ |
| InChIKey | QRUNJHHEQKQRNB-DUPDGBOPSA-N |
| XLogP | 1.99 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|