C11H13N7O — CID 6884689
2-(5-aminotetrazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]acetamide (PubChem CID 6884689) has the molecular formula C11H13N7O and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6884689 |
| Molecular Formula | C11H13N7O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N/NC(=O)Cn2nnc(N)n2)cc1 |
| InChI | InChI=1S/C11H13N7O/c1-8-2-4-9(5-3-8)6-13-14-10(19)7-18-16-11(12)15-17-18/h2-6H,7H2,1H3,(H2,12,16)(H,14,19)/b13-6+ |
| InChIKey | DJJRFLOADJDNOP-AWNIVKPZSA-N |
| XLogP | -0.29 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|