C14H13N7O — CID 6884494
2-(5-aminotetrazol-2-yl)-N-[(E)-naphthalen-1-ylmethylideneamino]acetamide (PubChem CID 6884494) has the molecular formula C14H13N7O and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(E)-naphthalen-1-ylmethylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-naphthalen-1-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6884494 |
| Molecular Formula | C14H13N7O |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-naphthalen-1-ylmethylideneamino]acetamide |
| SMILES | Nc1nnn(CC(=O)N/N=C/c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C14H13N7O/c15-14-18-20-21(19-14)9-13(22)17-16-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-8H,9H2,(H2,15,19)(H,17,22)/b16-8+ |
| InChIKey | IMXMCGADDRASII-LZYBPNLTSA-N |
| XLogP | 0.56 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|