C22H26N2O2 — CID 155518227
(R)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-prop-2-enoxyquinolin-4-yl)methanol (PubChem CID 155518227) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (R)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-prop-2-enoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-prop-2-enoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 155518227 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (R)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-prop-2-enoxyquinolin-4-yl)methanol |
| SMILES | C=CCOc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CCN3CC4=CC)c2c1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-11-26-17-5-6-20-19(13-17)18(7-9-23-20)22(25)21-12-16-8-10-24(21)14-15(16)4-2/h3-7,9,13,16,21-22,25H,1,8,10-12,14H2,2H3/t16-,21-,22+/m0/s1 |
| InChIKey | RIFDULDKDLGDTM-WQTXXOFMSA-N |
| XLogP | 3.87 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|