C24H30N2O2 — CID 155551816
(R)-(6-cyclopentyloxyquinolin-4-yl)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 155551816) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (R)-(6-cyclopentyloxyquinolin-4-yl)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (R)-(6-cyclopentyloxyquinolin-4-yl)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 155551816 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (R)-(6-cyclopentyloxyquinolin-4-yl)-[(2S,4S)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | CC=C1CN2CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccc(OC3CCCC3)cc12 |
| InChI | InChI=1S/C24H30N2O2/c1-2-16-15-26-12-10-17(16)13-23(26)24(27)20-9-11-25-22-8-7-19(14-21(20)22)28-18-5-3-4-6-18/h2,7-9,11,14,17-18,23-24,27H,3-6,10,12-13,15H2,1H3/t17-,23-,24+/m0/s1 |
| InChIKey | SWQLYYXPDDQWMR-YRUKQIKQSA-N |
| XLogP | 4.63 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|