C27H23N3O2S — CID 155518717
5-(1-hydroxynaphthalen-2-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 155518717) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is 5-(1-hydroxynaphthalen-2-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(1-hydroxynaphthalen-2-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 155518717 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 5-(1-hydroxynaphthalen-2-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2CC(c3ccc4ccccc4c3O)=NN2C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N3O2S/c1-32-21-14-11-19(12-15-21)25-17-24(23-16-13-18-7-5-6-10-22(18)26(23)31)29-30(25)27(33)28-20-8-3-2-4-9-20/h2-16,25,31H,17H2,1H3,(H,28,33) |
| InChIKey | MUDROYOJXNDCFW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|