C25H24FN3O4 — CID 155519979
N-[3-[[2-(4-acetyl-3-fluorophenoxy)acetyl]amino]phenyl]-4-(dimethylamino)benzamide (PubChem CID 155519979) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[3-[[2-(4-acetyl-3-fluorophenoxy)acetyl]amino]phenyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[3-[[2-(4-acetyl-3-fluorophenoxy)acetyl]amino]phenyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 155519979 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[3-[[2-(4-acetyl-3-fluorophenoxy)acetyl]amino]phenyl]-4-(dimethylamino)benzamide |
| SMILES | CC(=O)c1ccc(OCC(=O)Nc2cccc(NC(=O)c3ccc(N(C)C)cc3)c2)cc1F |
| InChI | InChI=1S/C25H24FN3O4/c1-16(30)22-12-11-21(14-23(22)26)33-15-24(31)27-18-5-4-6-19(13-18)28-25(32)17-7-9-20(10-8-17)29(2)3/h4-14H,15H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | RQCFNYSZDAYVKF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |