C14H11Br2N3O — CID 155519985
4,5-dibromo-N-(1H-indol-6-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 155519985) has the molecular formula C14H11Br2N3O and a molecular weight of 397.07 g/mol. Its IUPAC name is 4,5-dibromo-N-(1H-indol-6-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(1H-indol-6-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155519985 |
| Molecular Formula | C14H11Br2N3O |
| Molecular Weight | 397.07 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 4,5-dibromo-N-(1H-indol-6-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccc2cc[nH]c2c1)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C14H11Br2N3O/c15-10-6-12(19-13(10)16)14(20)18-7-8-1-2-9-3-4-17-11(9)5-8/h1-6,17,19H,7H2,(H,18,20) |
| InChIKey | ATWHQMJJWYAUEQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |