C23H25F3N4 — CID 155520015
2-methyl-6-piperidin-4-yl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 155520015) has the molecular formula C23H25F3N4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-methyl-6-piperidin-4-yl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 2-methyl-6-piperidin-4-yl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 155520015 |
| Molecular Formula | C23H25F3N4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-methyl-6-piperidin-4-yl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)(F)F)c2)c2cc(C3CCNCC3)ccc2n1 |
| InChI | InChI=1S/C23H25F3N4/c1-14(17-4-3-5-19(12-17)23(24,25)26)28-22-20-13-18(16-8-10-27-11-9-16)6-7-21(20)29-15(2)30-22/h3-7,12-14,16,27H,8-11H2,1-2H3,(H,28,29,30)/t14-/m1/s1 |
| InChIKey | VXPLFYVSXKLACJ-CQSZACIVSA-N |
| XLogP | 5.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |