C25H29NO4 — CID 155520953
7-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-3-yl]methoxy]-3,4-dimethylchromen-2-one (PubChem CID 155520953) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 7-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-3-yl]methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-3-yl]methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155520953 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 7-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-3-yl]methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCC3CCCN(Cc4ccc(CO)cc4)C3)cc2oc1=O |
| InChI | InChI=1S/C25H29NO4/c1-17-18(2)25(28)30-24-12-22(9-10-23(17)24)29-16-21-4-3-11-26(14-21)13-19-5-7-20(15-27)8-6-19/h5-10,12,21,27H,3-4,11,13-16H2,1-2H3 |
| InChIKey | BXCUGXRKJOGSPH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|