C14H22O5 — CID 155523764
[(E)-3-[(2R,3R,4S)-4-hydroxy-3,5,5-trimethyl-6-oxooxan-2-yl]but-2-enyl] acetate (PubChem CID 155523764) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is [(E)-3-[(2R,3R,4S)-4-hydroxy-3,5,5-trimethyl-6-oxooxan-2-yl]but-2-enyl] acetate.
| Compound Name | [(E)-3-[(2R,3R,4S)-4-hydroxy-3,5,5-trimethyl-6-oxooxan-2-yl]but-2-enyl] acetate |
|---|---|
| PubChem CID | 155523764 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(E)-3-[(2R,3R,4S)-4-hydroxy-3,5,5-trimethyl-6-oxooxan-2-yl]but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)[C@@H]1OC(=O)C(C)(C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C14H22O5/c1-8(6-7-18-10(3)15)11-9(2)12(16)14(4,5)13(17)19-11/h6,9,11-12,16H,7H2,1-5H3/b8-6+/t9-,11-,12-/m0/s1 |
| InChIKey | XIJHOISFQHRMER-BFGLKVALSA-N |
| XLogP | 1.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|