C36H40N4 — CID 155523866
1-(naphthalen-2-ylmethyl)-N'-propan-2-yl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboximidamide (PubChem CID 155523866) has the molecular formula C36H40N4 and a molecular weight of 528.74 g/mol. Its IUPAC name is 1-(naphthalen-2-ylmethyl)-N'-propan-2-yl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboximidamide.
| Compound Name | 1-(naphthalen-2-ylmethyl)-N'-propan-2-yl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 155523866 |
| Molecular Formula | C36H40N4 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 1-(naphthalen-2-ylmethyl)-N'-propan-2-yl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2c(c1)nc(-c1ccc3c(c1)C(C)(C)CCC3(C)C)n2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H40N4/c1-23(2)38-33(37)27-14-16-32-31(21-27)39-34(40(32)22-24-11-12-25-9-7-8-10-26(25)19-24)28-13-15-29-30(20-28)36(5,6)18-17-35(29,3)4/h7-16,19-21,23H,17-18,22H2,1-6H3,(H2,37,38) |
| InChIKey | XHTBGUDHBZLDQU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|