C22H34O3 — CID 155524348
[(1R,4E,7R,8Z,10E,14R)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-yl] acetate (PubChem CID 155524348) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1R,4E,7R,8Z,10E,14R)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-yl] acetate.
| Compound Name | [(1R,4E,7R,8Z,10E,14R)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-yl] acetate |
|---|---|
| PubChem CID | 155524348 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1R,4E,7R,8Z,10E,14R)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-trien-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C(C)=C/CC[C@@]2(C)O[C@@H]2CC/C(C)=C/C=C\1C(C)C |
| InChI | InChI=1S/C22H34O3/c1-15(2)19-11-9-16(3)10-12-21-22(6,25-21)13-7-8-17(4)14-20(19)24-18(5)23/h8-9,11,15,20-21H,7,10,12-14H2,1-6H3/b16-9+,17-8+,19-11-/t20-,21-,22-/m1/s1 |
| InChIKey | RTEQLOHRVQLSLS-TYFIHSNGSA-N |
| XLogP | 5.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|